| Identification |
| Name: | Butanoic acid,2-butoxy-1-methyl-2-oxoethyl ester |
| Synonyms: | Butyricacid, ester with butyl lactate (8CI);Lactic acid, butyl ester, butyrate (8CI);NSC 166507; |
| CAS: | 7492-70-8 |
| EINECS: | 231-326-3 |
| Molecular Formula: | C11H20O4 |
| Molecular Weight: | 216.27 |
| InChI: | InChI=1/C11H20O4/c1-4-6-8-14-11(13)9(3)15-10(12)7-5-2/h9H,4-8H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.972 |
| Refractive index: | 1.415-1.425 |
| Water Solubility: | slightly soluble in water; soluble in organic solvents, oils, propylene glycol |
| Solubility: | slightly soluble in water; soluble in organic solvents, oils, propylene glycol |
| Appearance: | Colorless to pale yellow liquid |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
