| Identification | |
| Name: | (S)-(+)-3-Methyl-2-butyl isocyanate |
| Synonyms: | (S)-3-METHYL-2-BUTYL ISOCYANATE |
| CAS: | 749261-38-9 |
| Molecular Formula: | C6H11NO |
| Molecular Weight: | 113.16 |
| InChI: | InChI=1/C6H11NO/c1-5(2)6(3)7-4-8/h5-6H,1-3H3/t6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2206 |
| Flash Point: | 28.3°C |
| Boiling Point: | 123.9°C at 760 mmHg |
| Density: | 0.88g/cm3 |
| Refractive index: | 1.436 |
| Specification: | Safety Statements:23-26-36/37/39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 28.3°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
