| Identification | |
| Name: | 10-Undecenoic acid,2-propen-1-yl ester |
| Synonyms: | 10-Undecenoicacid, 2-propenyl ester (9CI); 10-Undecenoic acid, allyl ester (6CI,8CI); Allyl10-undecenoate; NSC 62647 |
| CAS: | 7493-76-7 |
| EINECS: | 231-337-3 |
| Molecular Formula: | C14H24 O2 |
| Molecular Weight: | 224.34 |
| InChI: | InChI=1/C14H24O2/c1-3-5-6-7-8-9-10-11-12-14(15)16-13-4-2/h3-4H,1-2,5-13H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 93.4°C |
| Boiling Point: | 290.9°C at 760 mmHg |
| Density: | 0.885g/cm3 |
| Refractive index: | 1.45 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 93.4°C |
| Safety Data | |
 |
|
