Identification |
Name: | Heptanoic acid,2-(4-bromophenyl)-2-oxoethyl ester |
Synonyms: | Heptanoicacid, ester with 4'-bromo-2-hydroxyacetophenone (7CI); Heptanoic acid,p-bromophenacyl ester (6CI); NSC 407588 |
CAS: | 7498-81-9 |
Molecular Formula: | C15H19 Br O3 |
Molecular Weight: | 327.2136 |
InChI: | InChI=1/C15H19BrO3/c1-2-3-4-5-6-15(18)19-11-14(17)12-7-9-13(16)10-8-12/h7-10H,2-6,11H2,1H3 |
Molecular Structure: |
![(C15H19BrO3) Heptanoicacid, ester with 4'-bromo-2-hydroxyacetophenone (7CI); Heptanoic acid,p-bromophenacyl ester...](https://img1.guidechem.com/chem/e/dict/133/7498-81-9.jpg) |
Properties |
Flash Point: | 198.4°C |
Boiling Point: | 404.4°Cat760mmHg |
Density: | 1.277g/cm3 |
Refractive index: | 1.522 |
Flash Point: | 198.4°C |
Safety Data |
|
![](/images/detail_15.png) |