| Identification | |
| Name: | 2-Bromopropane |
| Synonyms: | Isopropyl bromide; ISOPROPYL BROMIDE; 2-bromo-propane; bromo-2-propane; sec-Propyl bromide |
| CAS: | 75-26-3 |
| EINECS: | 200-855-1 |
| Molecular Formula: | C3H7Br |
| Molecular Weight: | 122.99 |
| InChI: | InChI=1/C3H7Br/c1-3(2)4/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2344 |
| Density: | 1.31 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.425-1.427 |
| Water Solubility: | 0.3 g/100 mL |
| Solubility: | 0.3 g/100 mL in water |
| Appearance: | Colorless transparent liquid |
| Specification: | colourless liquid Safety Statements:53-16-45 53:Avoid exposure - obtain special instruction before use 16:Keep away from sources of ignition - No smoking 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| HS Code: | 29033036 |
| Storage Temperature: | Flammables area |
| Color: | Colorless liquid |
| Usage: | Used in the synthesis of pharmaceuticals, dyes and other organics. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
