| Identification | |
| Name: | Isopropylamine |
| Synonyms: | 2-Aminopropane; iso-Propyl-d7-amine; PropyldamineatomD ; monoisopropylamine; MIPA; |
| CAS: | 75-31-0 |
| EINECS: | 200-860-9 |
| Molecular Formula: | C3H9N |
| Molecular Weight: | 59.11 |
| InChI: | InChI=1/C3H9N/c1-3(2)4/h3H,4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1221 |
| Density: | 0.69 |
| Stability: | Stable. Extremely flammable - note low boiling point and low flash point. Readily forms explosive mixtures with air. Incompatible with strong oxidizing agents, acids, acid chlorides, acid anhydrides, perchloryl fluoride. |
| Refractive index: | 1.3725-1.3755 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | colourless liquid |
| Specification: |
? Isopropylamine ,?its cas register number is 75-31-0. It also can be called?1-Methylethylamine ; 2-Amino-propaan ; 2-Amino-propano ; 2-Aminopropan ; 2-Aminopropane ; Isopropilamina?; Isopropylamine ; Monoisopropylamine ; Propanal, 2-amino- ; Propane, 2-amino- ; sec-Propylamine . |
| Packinggroup: | I |
| Sensitive: | Air Sensitive |
| Color: | Colorless liquid [Note: A gas above 91 degrees F]. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
