Identification |
Name: | Ethanol, 1-amino-(8CI,9CI) |
Synonyms: | Acetaldehydeammonia (6CI,7CI); 1-Aminoethanol; Aldehyde ammonia; a-Aminoethyl alcohol |
CAS: | 75-39-8 |
EINECS: | 200-868-2 |
Molecular Formula: | C2H7 N O |
Molecular Weight: | 61.10 |
InChI: | InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 1841 |
Melting Point: | 95-97°C (dec.) |
Flash Point: | 22.7°C |
Boiling Point: | 109-111°C |
Density: | 0.967g/cm3 |
Refractive index: | 1.431 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Packinggroup: | III |
Flash Point: | 22.7°C |
Safety Data |
|
 |