| Identification | |
| Name: | Dichloromethylsilane |
| Synonyms: | Methyldichlorosilane; Methyldichloro Silane; |
| CAS: | 75-54-7 |
| EINECS: | 200-877-1 |
| Molecular Formula: | CH4Cl2Si |
| Molecular Weight: | 115.03 |
| InChI: | InChI=1/CH4Cl2Si/c1-4(2)3/h4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1242 |
| Flash Point: | -26? |
| Density: | 1.105 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.397-1.4 |
| Water Solubility: | DECOMPOSES |
| Solubility: | Insoluble |
| Appearance: | A colorless fuming liquid with a pungent odor. |
| Specification: | Colorless clear liquid Safety Statements:16-26-36/37/39-43-45-7/8-30 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 43:In case of fire, use ... (indicate in the space the precise type of fire-fighting equipment. If water increases the risk add - Never use water) 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 7/8:Keep container tightly closed and dry 30:Never add water to this product |
| Packinggroup: | I |
| Flash Point: | -26? |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air & Moisture Sensitive |
| Color: | Colorless liquid |
| Usage: | Monomer for silicone fluids. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
 |
|
