| Identification | |
| Name: | Carbonochloridic acid,3-methoxybutyl ester |
| Synonyms: | 3-Methoxybutylchloroformate |
| CAS: | 75032-87-0 |
| EINECS: | 278-058-3 |
| Molecular Formula: | C6H11 Cl O3 |
| Molecular Weight: | 166.6027 |
| InChI: | InChI=1/C6H11ClO3/c1-5(9-2)3-4-10-6(7)8/h5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -37 |
| Density: | 1.116 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.425 |
| Solubility: | Slightly soluble |
| Specification: |
3-Methoxybutyl chloroformate , its cas register number is 75032-87-0. It also can be called Carbonochloridic acid,3-methoxybutyl ester . |
| Packinggroup: | I |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
 |
|
