Identification |
Name: | Decanedioic acid,1,10-bis[2-(2-chloroethoxy)-1-methyl-2-oxoethyl] ester |
Synonyms: | Sebacicacid, diester with 2-chloroethyl lactate (8CI); NSC 406236 |
CAS: | 7510-81-8 |
Molecular Formula: | C20H32 Cl2 O8 |
Molecular Weight: | 471.3693 |
InChI: | InChI=1/C20H32Cl2O8/c1-15(19(25)27-13-11-21)29-17(23)9-7-5-3-4-6-8-10-18(24)30-16(2)20(26)28-14-12-22/h15-16H,3-14H2,1-2H3 |
Molecular Structure: |
![(C20H32Cl2O8) Sebacicacid, diester with 2-chloroethyl lactate (8CI); NSC 406236](https://img1.guidechem.com/chem/e/dict/104/7510-81-8.jpg) |
Properties |
Flash Point: | 164.5°C |
Boiling Point: | 531.5°Cat760mmHg |
Density: | 1.189g/cm3 |
Refractive index: | 1.474 |
Flash Point: | 164.5°C |
Safety Data |
|
![](/images/detail_15.png) |