| Identification | |
| Name: | Methyl L-leucinate hydrochloride |
| CAS: | 7517-19-3 |
| EINECS: | 231-375-0 |
| Molecular Formula: | C7H16ClNO2 |
| Molecular Weight: | 181.66 |
| InChI: | InChI=1/C7H15NO2.ClH/c1-5(2)4-6(8)7(9)10-3;/h5-6H,4,8H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.955 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 20 o (C=4.5, MEOH) |
| Water Solubility: | soluble |
| Solubility: | H2O: 50 mg/mL, clear, colorless |
| Appearance: | White crystalline powder |
| Specification: |
?L-leucine methyl ester , its CAS NO. is 7517-19-3, the synonyms are Methyl L-leucinate HCl ; Methyl L-leucinate hydrochloride . |
| HS Code: | 29224995 |
| Sensitive: | Hygroscopic |
| Safety Data | |
 |
|
