| Identification | |
| Name: | L-Phenylalanine methyl ester hydrochloride |
| Synonyms: | methyl L-phenylalaninate hydrochloride; H-Phe-OMe.HCl; H-Phe-OMe*HCl |
| CAS: | 7524-50-7 |
| EINECS: | 231-383-4 |
| Molecular Formula: | C10H13NO2?HCl |
| Molecular Weight: | 215.68 |
| InChI: | InChI=1/C10H13NO2.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 37 o (C=2, C2H5OH) |
| Appearance: | white to off-white fine crystalline powder |
| Specification: |
?Methyl L-phenylalaninate hydrochloride , its cas register number is 7524-50-7. It also can be called?L-Phenylalanine, methyl ester, hydrochloride ; Methyl (2S)-2-amino-3-phenylpropanoate hydrochloride ; L-Phenylalanine methyl ester hydrochloride .It is a?white to off-white fine crystalline powder. |
| HS Code: | 29224995 |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
C: Corrosive
|
 |
|
