| Identification |
| Name: | Morpholine, 4-methyl-,4-oxide |
| Synonyms: | 4-Methylmorpholine4-oxide;4-Methylmorpholine oxide;N-Methylmorpholine N-oxide;N-Methylmorpholine oxide;N-methylmorpholineN-oxide;NMMO;NMO;NSC 73198;NSC 82153; |
| CAS: | 7529-22-8 |
| EINECS: | 231-391-8 |
| Molecular Formula: | C5H11NO2 |
| Molecular Weight: | 117.15 |
| InChI: | InChI=1/C5H11NO2/c1-6(7)2-4-8-5-3-6/h2-5H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Boiling Point: | 118-119oC |
| Density: | 1,14 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | n20/D 1.43 |
| Appearance: | Colourless to slightly yellow transparent liquid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Refrigerator (approx 4 C). Store protected from moisture. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
