| Identification | |
| Name: | L(+)-Leucinol |
| Synonyms: | (2S)-2-amino-4-methyl-pentan-1-ol;1-Pentanol, 2-amino-4-methyl-, (S)-;L-(+)-Leucinol;L- Leucinol;L-Leu-ol;(S)-2-Amino-4-methylpentan-1-ol;Leucinol;L-Leucinol;[(2S)-1-hydroxy-4-methyl-pentan-2-yl]azanium;(S)-2-Amino-4-methyl-1-pentanol;(S)-(+)-Leucinol; |
| CAS: | 7533-40-6 |
| EINECS: | 231-400-5 |
| Molecular Formula: | C6H15NO |
| Molecular Weight: | 117.19 |
| InChI: | InChI=1/C6H15NO/c1-5(2)3-6(7)4-8/h5-6,8H,3-4,7H2,1-2H3/t6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 66 - 70 |
| Density: | 0.917 |
| Stability: | No data. |
| Refractive index: | 1.4496-1.4516 |
| Alpha: | 3 o (589NM, C=9, ETHANOL) |
| Appearance: | clear colorless to slightly yellow liquid |
| Specification: |
?L(+)-Leucinol , its cas register number is 7533-40-6. It also can be called?S-(+)-2-Amino-4-methyl-1-pentanol ;?(2S)-2-Amino-4-methylpentan-1-ol ; 1-Pentanol, 2-amino-4-methyl-, (S)- .It is a?clear colorless to slightly yellow liquid. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
