Identification |
Name: | 7-CHLORO-5-(2-CHLOROPHENYL)-1,5-DIHYDRO-4,1-BENZOTHIAZEPIN-2(3H)-ONE |
Synonyms: | 7-CHLORO-5-(2-CHLOROPHENYL)-1,5-DIHYDRO-4,1-BENZOTHIAZEPIN-2(3H)-ONE;CGP 37157;7-Chloro-5-(2-chlorophenyl)-1,5-dihydro-4,1-benzothiazepine-2(3H)-one |
CAS: | 75450-34-9 |
Molecular Formula: | C15H12ClNOS |
Molecular Weight: | 289.78 |
InChI: | InChI=1/C15H11Cl2NOS/c16-9-5-6-13-11(7-9)15(20-8-14(19)18-13)10-3-1-2-4-12(10)17/h1-7,15H,8H2,(H,18,19) |
Molecular Structure: |
 |
Properties |
Flash Point: | 244°C |
Boiling Point: | 479.8°C at 760 mmHg |
Density: | 1.384g/cm3 |
Refractive index: | 1.639 |
Biological Activity: | Selective antagonist of the mitochondrial Na + -Ca 2+ exchanger (IC 50 = 0.4 μ M). |
Flash Point: | 244°C |
Storage Temperature: | Store at RT |
Safety Data |
|
 |