Identification |
Name: | 3,5-Pyridinedicarboxylicacid, 2-cyano-1,4-dihydro-6-methyl-4-(3-nitrophenyl)-, 3-methyl5-(1-methylethyl) ester |
Synonyms: | CL 287389;Escor;FK 235;FR 34235;Nivadil;Nivadip;SKF 102362;dl-Nilvadipine; |
CAS: | 75530-68-6 |
Molecular Formula: | C19H19N3O6 |
Molecular Weight: | 385.38 |
InChI: | InChI=1/C19H19N3O6/c1-10(2)28-19(24)15-11(3)21-14(9-20)17(18(23)27-4)16(15)12-6-5-7-13(8-12)22(25)26/h5-8,10,16,21H,1-4H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 148-150ºC |
Flash Point: | 272.3 ºC |
Boiling Point: | 526.7 ºC at 760 mmHg |
Density: | 1.32 g/cm3 |
Refractive index: | 1.568 |
Appearance: | yellow prisms |
Specification: | Yellow Prisms usageEng:Used as an antihypertensive and antianginal |
Flash Point: | 272.3 ºC |
Usage: | Used as an antihypertensive and antianginal |
Safety Data |
|
|