| Identification | |
| Name: | 4-Methyl-1-Piperazine Carboxaldehyde |
| Synonyms: | 1-Formyl-4-methylpiperazine; 1-Methyl-4-formylpiperazine~4-Methylpiperazine-1-carboxaldehyde |
| CAS: | 7556-55-0 |
| EINECS: | -0 |
| Molecular Formula: | C6H12N2O |
| Molecular Weight: | 128.17 |
| InChI: | InChI=1/C6H12N2O/c1-7-2-4-8(6-9)5-3-7/h6H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >110°C |
| Boiling Point: | 236-238°C |
| Density: | 1.113g/cm3 |
| Refractive index: | 1.4910 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | >110°C |
| Safety Data | |
 |
|
