Identification |
Name: | 4-Methyl-1-Piperazine Carboxaldehyde |
Synonyms: | 1-Formyl-4-methylpiperazine; 1-Methyl-4-formylpiperazine~4-Methylpiperazine-1-carboxaldehyde |
CAS: | 7556-55-0 |
EINECS: | -0 |
Molecular Formula: | C6H12N2O |
Molecular Weight: | 128.17 |
InChI: | InChI=1/C6H12N2O/c1-7-2-4-8(6-9)5-3-7/h6H,2-5H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | >110°C |
Boiling Point: | 236-238°C |
Density: | 1.113g/cm3 |
Refractive index: | 1.4910 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | >110°C |
Safety Data |
|
 |