| Identification | |
| Name: | Isoquinoline,1,2,3,4-tetrahydro-4-phenyl- |
| Synonyms: | 1,2,3,4-Tetrahydro-4-phenylisoquinoline;4-Phenyl-1,2,3,4-tetrahydroisoquinoline |
| CAS: | 75626-12-9 |
| Molecular Formula: | C15H15 N |
| Molecular Weight: | 245.75 |
| InChI: | InChI=1/C15H15N.ClH/c1-2-6-12(7-3-1)15-11-16-10-13-8-4-5-9-14(13)15;/h1-9,15-16H,10-11H2;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 180.4°C |
| Boiling Point: | 374.6°C at 760 mmHg |
| Density: | 1.065 g/cm3 |
| Specification: | usageEng:An inhibitor of release of dopamine induced by methamphetamine |
| Flash Point: | 180.4°C |
| Storage Temperature: | Store at RT |
| Usage: | An inhibitor of release of dopamine induced by methamphetamine |
| Safety Data | |
 |
|
