| Identification |
| Name: | 1-(4-CHLORO-BENZYL)-1 H-INDOLE-3-CARBALDEHYDE |
| Synonyms: | 1-(4-CHLORO-BENZYL)-1 H-INDOLE-3-CARBALDEHYDE;AKOS B014321;CHEMBRDG-BB 5601604;ART-CHEM-BB B014321;ASISCHEM N15726;Oncrasin 1 |
| CAS: | 75629-57-1 |
| Molecular Formula: | C16H12ClNO |
| Molecular Weight: | 269.73 |
| InChI: | InChI=1/C16H12ClNO/c17-14-7-5-12(6-8-14)9-18-10-13(11-19)15-3-1-2-4-16(15)18/h1-8,10-11H,9H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 235.3°C |
| Boiling Point: | 465.5°C at 760 mmHg |
| Density: | 1.21g/cm3 |
| Refractive index: | 1.62 |
| Biological Activity: | Proapoptotic agent that induces abnormal nuclear aggregation of PKC ι and suppresses RNA transcription. Exhibits antiproliferative effects against various human tumor cell lines with K-Ras mutations (IC 50 ≤ 3 μ M) with minimal effects on normal epithelial cells and inhibits human xenograft growth by 75% in vivo . |
| Flash Point: | 235.3°C |
| Safety Data |
| |
 |
