| Identification | |
| Name: | 4-(4-amino-3-methyl-phenyl)-2-methyl-aniline |
| Synonyms: | 4-(4-amino-3-methyl-phenyl)-2-methyl-aniline |
| CAS: | 7563-59-9 |
| Molecular Formula: | C14H16N2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H16N2.ClH/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12;/h3-8H,15-16H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 129-131 deg C |
| Flash Point: | 205.1°C |
| Boiling Point: | 361°C at 760 mmHg |
| Solubility: | Sol in alc, ether, dil acids In water, 1,300 mg/l @ 25 deg C |
| Flash Point: | 205.1°C |
| Color: | White to reddish crystals or powder [Note: Darkens on exposure to air]. |
| Safety Data | |
 |
|
