| Identification | |
| Name: | Benzeneethanol, b-amino- |
| CAS: | 7568-92-5 |
| EINECS: | 260-287-5 |
| Molecular Formula: | C8H11 N O |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1S/C8H11NO/c9-8(6-10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.104 g/cm3 |
| Refractive index: | 1.5484 |
| Appearance: | White to light yellow powder |
| Specification: | White to light yellow powder usageEng:A chiral arylalkylamine used as organocatalysts. Used in the synthesis and chiral recognition properties of novel fluorescent chemosensors for amino acid. Safety Statements:45-36/37/39-26 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Storage Temperature: | Refrigerator |
| Usage: | A chiral arylalkylamine used as organocatalysts. Used in the synthesis and chiral recognition properties of novel fluorescent chemosensors for amino acid. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
