| Identification | |
| Name: | Boron trifluoride acetic acid complex |
| Synonyms: | Trifluoroborane - acetic acid (1:1) |
| CAS: | 7578-36-1 |
| EINECS: | 231-477-5 |
| Molecular Formula: | C2H4BF3O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C2H4O2.BF3/c1-2(3)4;2-1(3)4/h1H3,(H,3,4); |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Specification: |
The extinguishing agent of Boron trifluoride and Ndash ; Acetic acid complex (CAS NO.7578-36-1) are dry powder, foam, sand, carbon dioxide, water mist. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
