| Identification | |
| Name: | 3-Isopropoxybenzaldehyde |
| Synonyms: | 3-Isopropoxybenzaldehyde;Benzaldehyde, 3-(1-methylethoxy)- |
| CAS: | 75792-33-5 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-8(2)12-10-5-3-4-9(6-10)7-11/h3-8H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.036 g/cm3 |
| Refractive index: | 1.529 |
| Specification: |
The 3-Isopropoxybenzaldehyde is an organic compound with the formula C10H12O2. The systematic name of this chemical is 3-(propan-2-yloxy)benzaldehyde. With the CAS registry number 75792-33-5, it is also named as Benzaldehyde, 3-(1-methylethoxy)-. In addition, the molecular weight is 164.2. The other characteristics of this product can be summarized as: (1)ACD/LogP: 2.52; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 26.3 Å2; (7)Index of Refraction: 1.529; (8)Molar Refractivity: 48.9 cm3; (9)Molar Volume: 158.4 cm3; (10)Polarizability: 19.38×10-24 cm3; (11)Surface Tension: 35.1 dyne/cm; (12)Density: 1.036 g/cm3; (13)Flash Point: 107.5 °C; (14)Enthalpy of Vaporization: 49.43 kJ/mol; (15)Boiling Point: 256.8 °C at 760 mmHg; (16)Vapour Pressure: 0.0151 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
