| Identification | |
| Name: | 2-Nonenal, 4-hydroxy-,(2E)- |
| Synonyms: | (2E)-4-Hydroxy-2-nonenal;(E)-4-Hydroxy-2-nonenal; 4-Hydroxy-2(E)-nonenal; 4-Hydroxy-2-(E)-nonenal;4-Hydroxy-2-nonenal; 4-Hydroxy-2-trans-nonenal; 4-Hydroxynonenal |
| CAS: | 75899-68-2 |
| Molecular Formula: | C9H16 O2 |
| Molecular Weight: | 156.2221 |
| InChI: | InChI=1S/C9H16O2/c1-2-3-4-6-9(11)7-5-8-10/h5,7-9,11H,2-4,6H2,1H3/b7-5+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.941 g/cm3 |
| Water Solubility: | Solubile in DMSO, Ethanol, Hexane |
| Solubility: | Solubile in DMSO, Ethanol, Hexane |
| Appearance: | Colorless oil |
| Specification: |
HNE (CAS No.75899-68-2) is an α,β-unsaturated hydroxyalkenal which is produced by lipid peroxidation in cells.It is the primary alpha,beta-unsaturated hydroxyalkenal formed in this process.It has 3 reactive groups: an aldehyde, a double-bond at carbon 2, and a hydroxy group at carbon 4.It is found throughout animal tissues, and in higher quantities during oxidative stress due to the increase in the lipid peroxidation chain reaction, due to the increase in stress events.It has been hypothesized by several researchers to play a key role in cell signal transduction, in a variety of pathways from cell cycle events to cellular adhesion. |
| Storage Temperature: | -70°C |
| Safety Data | |
 |
|
