Identification |
Name: | Propanedioic acid,2-(1-methylethyl)-, 1,3-diethyl ester |
Synonyms: | Malonicacid, isopropyl-, diethyl ester (6CI,7CI,8CI);Propanedioic acid,(1-methylethyl)-, diethyl ester (9CI);(1-Methylethyl)propanedioic acid diethylester;Diethyl 2-(1-methylethyl)propanedioate;Diethyl 2-isopropylmalonate;Ethyl isopropylmalonate;Isopropylmalonic aciddiethyl ester;NSC 1007; |
CAS: | 759-36-4 |
EINECS: | 212-068-0 |
Molecular Formula: | C10H18O4 |
Molecular Weight: | 202.25 |
InChI: | InChI=1/C10H18O4/c1-5-13-9(11)8(7(3)4)10(12)14-6-2/h7-8H,5-6H2,1-4H3 |
Molecular Structure: |
 |
Properties |
Boiling Point: | 62 °C0.35 mm Hg(lit.) |
Density: | 0.981 |
Refractive index: | 1.419-1.421 |
Specification: | clear colorless liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Safety Data |
|
 |