| Identification | |
| Name: | Benzenebutanoic acid, b-amino-4-nitro-, (bR)- |
| Synonyms: | (R)-3-Amino-4-(4-nitrophenyl)butyric acid; |
| CAS: | 759448-14-1 |
| Molecular Formula: | C10H12N2O4 |
| Molecular Weight: | 224.21 |
| InChI: | InChI=1/C10H12N2O4/c11-8(6-10(13)14)5-7-1-3-9(4-2-7)12(15)16/h1-4,8H,5-6,11H2,(H,13,14)/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.352 g/cm3 |
| Refractive index: | 1.599 |
| Specification: |
The (R)-3-Amino-4-(4-nitrophenyl)butyric acid , its cas register number is 759448-14-1. Systematic name about this chemicals is (3R)-3-amino-4-(4-nitrophenyl)butanoic acid .Following are the physical and chemical properties about it: (1)Index of Refraction: 1.599 (2)Molar Refractivity: 56.67 cm3 (3)Molar Volume: 165.7 cm3 (4)Surface Tension: 63 dyne/cm (5)Enthalpy of Vaporization: 72.28 kJ/mol (6)Vapour Pressure: 3.63E-08 mmHg at 25 °C . It belongs to the API intermediates product category. This chemicals can be described computed from structure: |
| Safety Data | |
 |
|
