| Identification | |
| Name: | Benzo[b]thiophene-3-aceticacid, ethyl ester |
| Synonyms: | NSC 42320; |
| CAS: | 7597-68-4 |
| Molecular Formula: | C12H12O2S |
| Molecular Weight: | 220.29 |
| InChI: | InChI=1S/C12H12O2S/c1-2-14-12(13)7-9-8-15-11-6-4-3-5-10(9)11/h3-6,8H,2,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.208 g/cm3 |
| Specification: |
The Ethyl 2-(1-benzothiophen-3-yl)acetate with its cas register number is 7597-68-4. It also can be called as and the IUPAC Name about this chemical is ethyl 2-(1-benzothiophen-3-yl)acetate. Physical properties about Ethyl 2-(1-benzothiophen-3-yl)acetate are: (1)#H bond acceptors: 2; (2)#Freely Rotating Bonds: 4; (3)Polar Surface Area: 54.54Å2; (4)Index of Refraction: 1.608; (5)Molar Refractivity: 63.06 cm3; (6)Molar Volume: 182.3 cm3; (7)Polarizability: 25x10-24cm3; (8)Surface Tension: 46.1 dyne/cm; (9)Enthalpy of Vaporization: 57.45 kJ/mol; (10)Vapour Pressure: 0.000152 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
