| Identification | |
| Name: | 2-ethylbut-1-ene |
| Synonyms: | 1-Butene,2-ethyl- (6CI,8CI); 1,1-Diethylethene; 1,1-Diethylethylene; 2-Ethyl-1-butene;3-Methylenepentane; NSC 74120 |
| CAS: | 760-21-4 |
| EINECS: | 212-078-5 |
| Molecular Formula: | C6H12 |
| Molecular Weight: | 84.1595 |
| InChI: | InChI=1S/C6H12/c1-4-6(3)5-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 3/PG 2 |
| Melting Point: | −131.5-−131 °C(lit.) |
| Flash Point: | −15 °F |
| Boiling Point: | 64-65 °C(lit.) |
| Density: | 0.689 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.396(lit.) |
| Specification: |
2-Ethyl-1-butene ,its cas register number is 760-21-4. It also can be called Pentane, 3-methylene- ; 3-Methylenepentane ; and 1-Butene, 2-ethyl- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | −15 °F |
| Safety Data | |
| Hazard Symbols | |
 |
|
