| Identification | |
| Name: | methacrylic anhydride |
| Synonyms: | 2-Methylacrylic acid anhydride |
| CAS: | 760-93-0 |
| EINECS: | 212-084-8 |
| Molecular Formula: | C8H10O3 |
| Molecular Weight: | 154.16 |
| InChI: | InChI=1/C8H10O3/c1-5(2)7(9)11-8(10)6(3)4/h1,3H2,2,4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Flash Point: | 184? |
| Density: | 1.035 |
| Stability: | Stable. Flammable. Moisture-sensitive. |
| Refractive index: | 1.453 |
| Solubility: | Slightly soluble |
| Appearance: | liquid |
| Specification: |
Methacrylic anhydride , its CAS NO. is 760-93-0, the synonyms are 1-Methylacrylic anhydride ; 2-Propenoicacid,2-methyl-,anhydride ; 2-Methyl-2-propenoicacianhydride ; Methacrylic acid anhydride ; Methacryloyl anhydride ; Methacrylicacidanhydride ; Methacryloylanhydride . Methacrylic anhydride (CAS NO.760-93-0) reacts exothermically with water. The reactions are sometimes slow, but can become violent when local heating accelerates their rate. Acids accelerate the reaction with water. Incompatible with acids, strong oxidizing agents, alcohols, amines, and bases. |
| Report: |
EPA Extremely Hazardous Substances List. Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 184? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
