Benzoic acid,2,5-dichloro-3-hydroxy-6-methoxy- (7600-50-2)

The 2,5-Dichloro-3-hydroxy-6-methoxybenzoic acid with its cas register number is 7600-50-2. It also can be called as 3,6-Dichloro-5-hydroxy-o-anisic acid and the IUPAC Name about this chemical is 2,5-dichloro-3-hydroxy-6-methoxybenzoic acid. It belongs to the following product categories, such as

Physical properties about 2,5-Dichloro-3-hydroxy-6-methoxybenzoic acid are: (1)ACD/LogP: 2.55; (2)ACD/LogD (pH 5.5): -0.36; (3)ACD/LogD (pH 7.4): -0.64; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 4; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 3; (11)Polar Surface Area: 44.76Ų; (12)Index of Refraction: 1.611; (13)Molar Refractivity: 51.53 cm³; (14)Molar Volume: 148.2 cm³; (15)Polarizability: 20.42x10^-24cm³; (16)Surface Tension: 60 dyne/cm; (17)Enthalpy of Vaporization: 66.68 kJ/mol; (18)Vapour Pressure: 1.43E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC1=C(C=C(C(=C1C(=O)O)Cl)O)Cl
(2)InChI: InChI=1S/C8H6Cl2O4/c1-14-7-3(9)2-4(11)6(10)5(7)8(12)13/h2,11H,1H3,(H,12,13)
(3)InChIKey: XYHBJALHMANCCC-UHFFFAOYSA-N