| Identification | |
| Name: | Ethyl 5-bromo-2-chlorobenzoate |
| Synonyms: | 5-Bromo-2-chlorobenzoicacid ethyl ester; Ethyl 5-bromo-2-chlorobenzoate |
| CAS: | 76008-73-6 |
| Molecular Formula: | C9H8BrClO2 |
| Molecular Weight: | 263.515 |
| InChI: | InChI=1S/C9H8BrClO2/c1-2-13-9(12)7-5-6(10)3-4-8(7)11/h3-5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >230 °F |
| Boiling Point: | 288 °C(lit.) |
| Density: | 1.48 |
| Refractive index: | n20/D 1.56(lit.) |
| Appearance: | White to light yellow crystal powder |
| Specification: | White to light yellow crystal powder Safety Statements:45-36/37/39-37/38/46-36 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Flash Point: | >230 °F |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
