| Identification |
| Name: | Imidazo[1,2-a]pyridine-3-acetonitrile,2-methyl-8-(phenylmethoxy)- |
| Synonyms: | Sch 28080 |
| CAS: | 76081-98-6 |
| Molecular Formula: | C17H15 N3 O |
| Molecular Weight: | 277.32 |
| InChI: | InChI=1/C17H15N3O/c1-13-15(9-10-18)20-11-5-8-16(17(20)19-13)21-12-14-6-3-2-4-7-14/h2-8,11H,9,12H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.16g/cm3 |
| Refractive index: | 1.615 |
| Biological Activity: | Potent inhibitor of H + ,K + -ATPase (IC 50 = 20 nM); binds to the K + recognition site and is competitive with respect to K + . Inhibits gastric acid secretion in vitro and in vivo . |
| Storage Temperature: | −20°C |
| Color: | white to light tan |
| Safety Data |
| |
 |
