| Identification | |
| Name: | Peroxide,bis(1-oxooctyl) |
| Synonyms: | Octanoylperoxide (6CI,8CI); Caprylyl peroxide; Di-n-octanoyl peroxide; Dicaprylylperoxide; Dioctanoyl peroxide; Perkadox SE 8; Peroyl O |
| CAS: | 762-16-3 |
| EINECS: | 212-094-2 |
| Molecular Formula: | C16H30 O4 |
| Molecular Weight: | 286.46 |
| InChI: | InChI=1/C16H30O4/c1-3-5-7-9-11-13-15(17)19-20-16(18)14-12-10-8-6-4-2/h3-14H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3106 |
| Melting Point: | 29 deg C |
| Flash Point: | 149.3°C |
| Boiling Point: | 353.5°C at 760 mmHg |
| Density: | 0.955g/cm3 |
| Refractive index: | 1.444 |
| Specification: |
Caprolyl Peroxide (CAS NO.762-16-3) is a straw-colored liquid with sharp odor.It is highly flammable and water insoluble. Peroxides, such as dioctanoyl peroxide, are good oxidizing agents. Organic compounds can ignite on contact with concentrated peroxides. Strongly reduced material such as sulfides, nitrides, and hydrides may react explosively with peroxides. There are few chemical classes that do not at least produce heat when mixed with peroxides. Many produce explosions or generate gases (toxic and nontoxic). Generally, dilute solutions of peroxides (<70%) are safe, but the presence of a catalyst (often a transition metal such as cobalt, iron, manganese, nickel, or vanadium) as an impurity may even then cause rapid decomposition, a buildup of heat, and even an explosion. Solutions of peroxides often become explosive when evaporated to dryness or near-dryness. Danger of explosion when dry. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 149.3°C |
| Safety Data | |
 |
|
