| Identification | |
| Name: | Diethyl acetylenedicarboxylate |
| Synonyms: | :2-Butynedioic acid diethyl ester; Diethyl butynedioate: |
| CAS: | 762-21-0 |
| EINECS: | 212-095-8 |
| Molecular Formula: | C8H10O4 |
| Molecular Weight: | 170.16 |
| InChI: | InChI=1/C8H10O4/c1-3-11-7(9)5-6-8(10)12-4-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.06 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.441-1.443 |
| Solubility: | Insoluble |
| Appearance: | clear light yellow liquid |
| Specification: |
Diethyl 2-butynedioate , with CAS number of 762-21-0, can be called 2-butynedioic acid, diethyl ester ; 2-Butynedioic acid, diethyl ester . It is a clear light yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29171990 |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
