| Identification | |
| Name: | Carbamic acid,butylnitroso-, 1-naphthalenyl ester (9CI) |
| Synonyms: | 1-Naphthyl-N-butyl-N-nitrosocarbamate |
| CAS: | 76206-38-7 |
| Molecular Formula: | C15H16 N2 O3 |
| Molecular Weight: | 272.2 |
| InChI: | InChI=1/C15H16N2O3/c1-2-3-11-17(16-19)15(18)20-14-10-6-8-12-7-4-5-9-13(12)14/h4-10H,2-3,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 190.3°C |
| Boiling Point: | 391.1°C at 760 mmHg |
| Density: | 1.16g/cm3 |
| Refractive index: | 1.571 |
| Specification: |
N-Butyl-N-nitrosocarbamic acid 1-naphthyl ester , its cas register number is 76206-38-7. It also can be called 1-Naphthyl N-butyl-N-nitrosocarbamate .When heated to decomposition it emits toxic fumes of NOx. The storage environment of N-Butyl-N-nitrosocarbamic acid 1-naphthyl ester (CAS NO.76206-38-7) should be ventilate, low-temperature and dry. |
| Flash Point: | 190.3°C |
| Safety Data | |
 |
|
