| Identification | |
| Name: | 2-METHYLPENTENE |
| Synonyms: | 2-methyl-1-penten;2-methyl-pent-1-ene;2-Methylpentene;2-Methyl-pentene-1;4-Methyl-4-pentene;C2H5CH2C(CH3)=CH2;2-METHYL-1-PENTENE;2-PROPYLPROPENE |
| CAS: | 763-29-1 |
| EINECS: | 212-108-7 |
| Molecular Formula: | C6H12 |
| Molecular Weight: | 84.18 |
| InChI: | InChI=1/C6H12/c1-4-5-6(2)3/h2,4-5H2,1,3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2288 3/PG 2 |
| Melting Point: | -136 °C |
| Flash Point: | −15 °F |
| Boiling Point: | 62 °C(lit.) |
| Density: | 0.682 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.392(lit.) |
| Specification: |
2-Methylpentene (CAS NO.763-29-1) is a clear colorless liquid. It can floats on water. Irritating vapor. It react vigorously with strong oxidizing agents and may react exothermically with reducing agents to release hydrogen gas. In the presence of various catalysts (such as acids) or initiators, may undergo exothermic addition polymerization reactions. Inhalation: May produce anesthetic effects. Eyes: Moderate eye irritation possible. Behavior in Fire: Can react vigorously with oxidizing materials. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | −15 °F |
| Storage Temperature: | 0-6°C |
| Safety Data | |
 |
|
