| Identification |
| Name: | 1-Propanone,2-amino-1-phenyl-, hydrochloride (1:1), (2R)- |
| Synonyms: | 1-Propanone,2-amino-1-phenyl-, hydrochloride, (2R)- (9CI); 1-Propanone, 2-amino-1-phenyl-,hydrochloride, (R)-; (+)-(R)-Cathinone hydrochloride; Cathinone hydrochloride |
| CAS: | 76333-53-4 |
| Molecular Formula: | C9H11 N O . Cl H |
| Molecular Weight: | 185.65 |
| InChI: | InChI=1/C9H11NO.ClH/c1-7(10)9(11)8-5-3-2-4-6-8;/h2-7H,10H2,1H3;1H/t7-;/m1./s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 108°C |
| Boiling Point: | 255°C at 760 mmHg |
| Flash Point: | 108°C |
| Usage: | Psychoactive alkaloid found in the leaves of the khat plant, Catha edulis Forsk., Celastraceae.
Controlled substance (stimulant) |
| Safety Data |
| |
 |
