| Identification | |
| Name: | [1,1'-Biphenyl]-3-methanol,2-methyl- |
| Synonyms: | 2-Methyl-3-phenylbenzylalcohol;2-Methylbiphenyl-3-ylmethanol;3-Hydroxymethyl-2-methylbiphenyl; |
| CAS: | 76350-90-8 |
| Molecular Formula: | C14H14O |
| Molecular Weight: | 198.26 |
| InChI: | InChI=1/C14H14O/c1-11-13(10-15)8-5-9-14(11)12-6-3-2-4-7-12/h2-9,15H,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.072g/cm3 |
| Refractive index: | 1.587 |
| Solubility: | Insoluble in water, soluble in ethanol, benzene and toluene |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powde usageEng:Bifenthrin intermediate. |
| Usage: | Bifenthrin intermediate. |
| Safety Data | |
 |
|
