| Identification | |
| Name: | ETHYL 4-(METHYLAMINO)-2-(METHYLSULFANYL)-5-PYRIMIDINECARBOXYLATE |
| Synonyms: | ETHYL 4-(METHYLAMINO)-2-(METHYLSULFANYL)-5-PYRIMIDINECARBOXYLATE;4-(Methylamino)-2-(methylthio)pyrimidine-5-carboxylic Acid Ethyl Ester |
| CAS: | 76360-82-2 |
| Molecular Formula: | C9H13N3O2S |
| Molecular Weight: | 227.28 |
| InChI: | InChI=1S/C9H13N3O2S/c1-4-14-8(13)6-5-11-9(15-3)12-7(6)10-2/h5H,4H2,1-3H3,(H,10,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 176.9 °C |
| Boiling Point: | 368.9 °C at 760 mmHg |
| Density: | 1.24 g/cm3 |
| Specification: | White Solid usageEng:An intermediate in the preparation of antitumor agents, antiinflammatory agents and tyrosine kinase inhibitors |
| Flash Point: | 176.9 °C |
| Usage: | An intermediate in the preparation of antitumor agents, antiinflammatory agents and tyrosine kinase inhibitors |
| Safety Data | |
 |
|
