| Identification | |
| Name: | 10H-Phenothiazine-10-ethanamine,N,N,a-trimethyl-, 5-oxide |
| Synonyms: | Phenothiazine,10-[2-(dimethylamino)propyl]-, 5-oxide (7CI,8CI); Diprazin sulfoxide;N-[2-(Dimethylamino)propyl]phenothiazine S-oxide; Promethazine 5-oxide;Promethazine 5-sulfoxide; Promethazine sulfoxide; Romergan sulfoxide |
| CAS: | 7640-51-9 |
| Molecular Formula: | C17H20 N2 O S |
| Molecular Weight: | 300.42 |
| InChI: | InChI=1/C17H20N2OS/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)21(20)17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 |
| Molecular Structure: | ![(C17H20N2OS) Phenothiazine,10-[2-(dimethylamino)propyl]-, 5-oxide (7CI,8CI); Diprazin sulfoxide;N-[2-(Dimethylami...](https://img1.guidechem.com/chem/e/dict/34/7640-51-9.jpg) |
| Properties | |
| Flash Point: | 233°C |
| Boiling Point: | 461.6°C at 760 mmHg |
| Density: | 1.27g/cm3 |
| Refractive index: | 1.678 |
| Specification: | usageEng:A metabolite of Promethazine (P757000). |
| Flash Point: | 233°C |
| Storage Temperature: | Refrigerator |
| Usage: | A metabolite of Promethazine |
| Safety Data | |
 |
|
