Identification |
Name: | L-Phenylalanine,4-borono- |
Synonyms: | 4-Borono-L-phenylalanine;L-BPA;L-p-Boronophenylalanine;4-boronophenylalanine;4-(dihydroxyboranyl)-L-phenylalanine;4-(Dihydroxyboryl)-L-phenylalanine;L-Phenylalanine, 4-borono-;p-Borono-L-phenylalanine;4-Borono-L-phenylalanine B10 enriched; |
CAS: | 76410-58-7 |
Molecular Formula: | C9H12BNO4 |
Molecular Weight: | 209.0069 |
InChI: | InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m0/s1 |
Molecular Structure: |
 |
Properties |
Density: | 1.34 g/cm3 |
Refractive index: | 1.59 |
Specification: | white to off-white powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |