| Identification | |
| Name: | Benzoic acid,4-(cyanomethyl)-, methyl ester |
| Synonyms: | p-Toluicacid, a-cyano-, methyl ester (7CI);4-Cyanomethylbenzoic acid methyl ester; Methyl 4-cyanomethylbenzoate; Methylp-(cyanomethyl)benzoate; Methyl a-cyano-p-toluate; [p-(Methoxycarbonyl)phenyl]acetonitrile |
| CAS: | 76469-88-0 |
| Molecular Formula: | C10H9 N O2 |
| Molecular Weight: | 175.19 |
| InChI: | InChI=1/C10H9NO2/c1-13-10(12)9-4-2-8(3-5-9)6-7-11/h2-5H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 145.9°C |
| Boiling Point: | 110 °C0.2 mm Hg(lit.) |
| Density: | 1.141g/cm3 |
| Refractive index: | 1.53 |
| Specification: |
Methyl 4-(cyanomethyl)benzoate (76469-88-0) is also called for 4-(Cyanomethyl)benzoic acid methyl ester , used as organic intermediate raw material. |
| Flash Point: | 145.9°C |
| Usage: | The key intermediate of Fexofenadine (F322490). |
| Safety Data | |
 |
|
