| Identification | |
| Name: | 4-Pyridineethanamine,2-methoxy- |
| Synonyms: | 4-Pyridineethanamine,2-methoxy-(9CI);4-Pyridineethanamine, 2-methoxy- |
| CAS: | 764708-27-2 |
| Molecular Formula: | C8H12 N2 O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H12N2O/c1-11-8-6-7(2-4-9)3-5-10-8/h3,5-6H,2,4,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 108.43°C |
| Boiling Point: | 255.677°C at 760 mmHg |
| Density: | 1.063g/cm3 |
| Refractive index: | 1.528 |
| Specification: |
The 2-Methoxy-4-pyridineethanamine with the CAS number 764708-27-2 is also called 4-Pyridineethanamine,2-methoxy-. Both the systematic name and IUPAC name are 2-(2-methoxypyridin-4-yl)ethanamine. Its molecular formula is C8H12N2O. The product category is Methyl. The properties of the 2-Methoxy-4-pyridineethanamine are: (1)ACD/LogP: 0.83; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1.537; (7)#H bond acceptors: 3; (8)#H bond donors: 2; (9)#Freely Rotating Bonds: 4; (10)Polar Surface Area: 48.14 Å2; (11)Index of Refraction: 1.528; (12)Molar Refractivity: 44.107 cm3; (13)Molar Volume: 143.154 cm3; (14)Polarizability: 17.485×10-24cm3; (15)Surface Tension: 41.674 dyne/cm; (16)Enthalpy of Vaporization: 49.316 kJ/mol; (17)Vapour Pressure: 0.016 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 108.43°C |
| Safety Data | |
 |
|
