| Identification | |
| Name: | 3-Ethylrhodanine |
| Synonyms: | 3-Ethyl-2-thioxo-1,3-thiazolidin-4-one |
| CAS: | 7648-01-3 |
| EINECS: | 231-603-9 |
| Molecular Formula: | C5H7NOS2 |
| Molecular Weight: | 161.247 |
| InChI: | InChI=1S/C5H7NOS2/c1-2-6-4(7)3-9-5(6)8/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 36-39 °C(lit.) |
| Flash Point: | >230 °F |
| Boiling Point: | 128 °C4 mm Hg(lit.) |
| Density: | 1.303 g/mL at 25 °C(lit.) |
| Refractive index: | 1.65 |
| Appearance: | yellow to orange-brown powder |
| Specification: |
3-Ethylrhodanine (CAS NO.7648-01-3) is also called 3-Ethyl-2-thioxo-4-thiazolidinone ; 3-Ethylrodanin ; 4-27-00-03189 (Beilstein Handbook Reference) ; BRN 0121471 ; N-Ethylrhodanine ; NSC 81656 ; Rhodanine, 3-ethyl- . 3-Ethylrhodanine (CAS NO.7648-01-3) is yellow to orange-brown powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | >230 °F |
| Storage Temperature: | 0-6°C |
| Safety Data | |
 |
|
