| Identification | |
| Name: | Cyclopropyl methyl ketone |
| Synonyms: | Acetylcyclopropane; ACETYLTRIMETHYLENE; AKOS BBS-00004282; 1-CYCLOPROPYL-1-ETHANONE; 1-CYCLOPROPYL-ETHANONE; CPMK; METHYL CYCLOPROPYL KETONE; 1-cyclopropyl-ethanon; Cyclopropylethanone; Ketone, cyclopropyl methyl; ketone,cyclopropylmethyl |
| CAS: | 765-43-5 |
| EINECS: | 212-146-4 |
| Molecular Formula: | C5H8O |
| Molecular Weight: | 84.12 |
| InChI: | InChI=1/C5H8O/c1-4(6)5-2-3-5/h5H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 3 |
| Melting Point: | <-70 oC |
| Density: | 0.903 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.422-1.426 |
| Solubility: | Very soluble |
| Appearance: | clear colorless to very slightly yellow liquid |
| Specification: |
? Cyclopropyl methyl ketone (CAS NO.765-43-5), its Synonyms are Ethanone, 1-cyclopropyl- ; Ethanone, 1-cyclopropyl- (9CI) ; Ketone, cyclopropyl methyl (8CI) ; Methyl cyclopropyl ketone ; Acetylcyclopropane . |
| Packinggroup: | II |
| HS Code: | 29142900 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
