| Identification | |
| Name: | 6-Isoquinolinol |
| Synonyms: | 6-Hydroxyisoquinoline |
| CAS: | 7651-82-3 |
| EINECS: | 231-612-8 |
| Molecular Formula: | C9H7 N O |
| Molecular Weight: | 145.16 |
| InChI: | InChI=1/C9H7NO/c11-9-2-1-8-6-10-4-3-7(8)5-9/h1-6,11H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 220ºC |
| Density: | 1.26 g/cm3 |
| Refractive index: | 1.691 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
Isoquinolin-6-ol , its cas register number is 7651-82-3. It also can be called EINECS 231-612-8 .It is a white to light yellow crystal powder. |
| Safety Data | |
 |
|
