Identification |
Name: | 2-Propen-1-one,1,3-bis(1,3-benzodioxol-5-yl)- |
Synonyms: | Chalcone,3,4:3',4'-bis(methylenedioxy)- (7CI); Bis(3,4-methylenedioxy)chalcone; NSC162494 |
CAS: | 76530-89-7 |
Molecular Formula: | C17H12 O5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C17H12O5/c18-13(12-3-6-15-17(8-12)22-10-20-15)4-1-11-2-5-14-16(7-11)21-9-19-14/h1-8H,9-10H2/b4-1+ |
Molecular Structure: |
|
Properties |
Flash Point: | 220.3°C |
Boiling Point: | 490.1°C at 760 mmHg |
Density: | 1.396g/cm3 |
Refractive index: | 1.671 |
Flash Point: | 220.3°C |
Usage: | Used for the treatment of amyloid diseases and synucleinopathies such as Alzheimer disease, type 2 diabetes, and Parkinson disease. |
Safety Data |
|
|