Identification |
Name: | a-D-Mannofuranose, cyclic2,3-carbonate (9CI) |
Synonyms: | Furo[3,4-d]-1,3-dioxole,a-D-mannofuranose deriv. |
CAS: | 76548-27-1 |
Molecular Formula: | C7H10 O7 |
Molecular Weight: | 0 |
InChI: | InChI=1/C7H10O7/c8-1-2-3(9)4-5(6(10)12-2)14-7(11)13-4/h2-6,8-10H,1H2/t2?,3-,4?,5-,6+/m1/s1 |
Molecular Structure: |
![(C7H10O7) Furo[3,4-d]-1,3-dioxole,a-D-mannofuranose deriv.](https://img1.guidechem.com/chem/e/dict/32/76548-27-1.jpg) |
Properties |
Flash Point: | 253.72°C |
Boiling Point: | 602.999°C at 760 mmHg |
Density: | 1.678g/cm3 |
Refractive index: | 1.566 |
Flash Point: | 253.72°C |
Usage: | Used for the synthesis of a-mannosides |
Safety Data |
|
 |