| Identification | |
| Name: | D-Glucose, 6-deoxy- |
| Synonyms: | 6-Deoxy-D-glucose;6-Deoxyglucose; D-6-Deoxyglucose; D-Chinovose; D-Isorhamnose; D-Quinovose;Epirhamnose, D-; Glucomethylose; Isorhamnose; Isorhodeose; Quinovose |
| CAS: | 7658-08-4 |
| EINECS: | 231-622-2 |
| Molecular Formula: | C6H12 O5 |
| Molecular Weight: | 164.1565 |
| InChI: | InChI=1/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3-,4+,5-,6+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.41 g/cm3 |
| Refractive index: | 1.593 |
| Water Solubility: | H2O: 10 mg/mL, clear, colorless |
| Solubility: | H2O: 10 mg/mL, clear, colorless |
| Specification: |
6-Deoxy-D-glucose , its cas register number is 7658-08-4. It also can be called 6-Deoxyglucose ; Quinovose ; EINECS 231-622-2 . 6-Deoxy-D-glucose (CAS NO.7658-08-4) should be kept in a cool place. |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
