| Identification | |
| Name: | 3,5-DINITROCATECHOL |
| Synonyms: | 3,5-DINITROCATECHOL;3,5-DINITRO-1,2-BENZENEDIOL;3,5-dinitro-2-benzenediol;3,5-dinitropyrocatechol;OR-486;3,5-DINITROCATECHOL (OR-486) (SELECTIVE INHIBITOR OF CATECHOL;1,2-Benzenediol, 3,5-dinitro- (9CI);3,5-Dinitro-1,2-benzenediol, OR-486 |
| CAS: | 7659-29-2 |
| Molecular Formula: | C6H4N2O6 |
| Molecular Weight: | 200.11 |
| InChI: | InChI=1/C6H4N2O6/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h1-2,9-10H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 162.2°C |
| Boiling Point: | 354.5°C at 760 mmHg |
| Density: | 1.819g/cm3 |
| Refractive index: | 1.712 |
| Biological Activity: | Potent and selective inhibitor of catechol-O-methyl-transferase. |
| Flash Point: | 162.2°C |
| Storage Temperature: | 2-8°C |
| Color: | yellow |
| Safety Data | |
 |
|
